CAS 161373-05-3 is the registry number for 3–phenethylbenzoic acid. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
3-(2-phenylethyl)benzoic acid (CAS 161373-05-3) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 3-(2-phenylethyl)benzoic acid. InChIKey: JAHAEINDORLHMF-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 3-(2-phenylethyl)benzoic acid |
| InChIKey | JAHAEINDORLHMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)