CAS 16147-09-4 is the registry number for 2-Iodo-4,6-dimethoxybenzaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-iodo-4,6-dimethoxybenzaldehyde (CAS 16147-09-4) is a chemical compound with the molecular formula C9H9IO3 and a molecular weight of 292.07 g/mol. IUPAC name: 2-iodo-4,6-dimethoxybenzaldehyde. InChIKey: IDJCBCLPEONUPQ-UHFFFAOYSA-N.
| Molecular formula | C9H9IO3 |
|---|---|
| Molecular weight | 292.07 g/mol |
| IUPAC name | 2-iodo-4,6-dimethoxybenzaldehyde |
| InChIKey | IDJCBCLPEONUPQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)I)C=O)OC |
Computed by PubChem (NCBI)