Products 1615702-62-9
CAS 1615702-62-9 is the registry number for 2-Hydroxy-3-(6-methoxynaphthalen-2-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-3-(6-methoxynaphthalen-2-yl)propanoic acid (CAS 1615702-62-9) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: 2-hydroxy-3-(6-methoxynaphthalen-2-yl)propanoic acid. InChIKey: WPNNCQVKRBCULD-UHFFFAOYSA-N.
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 2-hydroxy-3-(6-methoxynaphthalen-2-yl)propanoic acid |
| InChIKey | WPNNCQVKRBCULD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)CC(C(=O)O)O |
Computed by PubChem (NCBI)