Products 1616289-20-3
CAS 1616289-20-3 is the registry number for 5,8-Dichloro-7-hydroxy-3,4-dihydroisoquinolin-1(2H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,8-dichloro-7-hydroxy-3,4-dihydro-2H-isoquinolin-1-one (CAS 1616289-20-3) is a chemical compound with the molecular formula C9H7Cl2NO2 and a molecular weight of 232.06 g/mol. IUPAC name: 5,8-dichloro-7-hydroxy-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: MIWTYLAFUURIPJ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO2 |
|---|---|
| Molecular weight | 232.06 g/mol |
| IUPAC name | 5,8-dichloro-7-hydroxy-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | MIWTYLAFUURIPJ-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C(C(=CC(=C21)Cl)O)Cl |
Computed by PubChem (NCBI)