Products 18982-44-0
CAS 18982-44-0 appears in our catalog under these names: 1-(2,4-Dichlorophenyl)-2-nitropropene, 95%, 2,4-Dichloro-β-methyl-β-nitrostyrene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 5g.
2,4-dichloro-1-(2-nitroprop-1-enyl)benzene (CAS 18982-44-0) is a chemical compound with the molecular formula C9H7Cl2NO2 and a molecular weight of 232.06 g/mol. IUPAC name: 2,4-dichloro-1-(2-nitroprop-1-enyl)benzene. InChIKey: ZAQYCITZNLAPDI-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO2 |
|---|---|
| Molecular weight | 232.06 g/mol |
| IUPAC name | 2,4-dichloro-1-(2-nitroprop-1-enyl)benzene |
| InChIKey | ZAQYCITZNLAPDI-UHFFFAOYSA-N |
| SMILES | CC(=CC1=C(C=C(C=C1)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)