Products 341026-04-8
CAS 341026-04-8 is the registry number for 1-(3,5-Dichloropyridin-2-yl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,5-dichloro-2-pyridinyl)cyclopropane-1-carboxylic acid (CAS 341026-04-8) is a chemical compound with the molecular formula C9H7Cl2NO2 and a molecular weight of 232.06 g/mol. IUPAC name: 1-(3,5-dichloro-2-pyridinyl)cyclopropane-1-carboxylic acid. InChIKey: LNILAHNEWXNQQK-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO2 |
|---|---|
| Molecular weight | 232.06 g/mol |
| IUPAC name | 1-(3,5-dichloro-2-pyridinyl)cyclopropane-1-carboxylic acid |
| InChIKey | LNILAHNEWXNQQK-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=C(C=N2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)