Products 54143-00-9
CAS 54143-00-9 is the registry number for 1-(2-2-Dichloro-1-methylvinyl)-2-nitrobenzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
1-(1,1-dichloroprop-1-en-2-yl)-2-nitrobenzene (CAS 54143-00-9) is a chemical compound with the molecular formula C9H7Cl2NO2 and a molecular weight of 232.06 g/mol. IUPAC name: 1-(1,1-dichloroprop-1-en-2-yl)-2-nitrobenzene. InChIKey: YLZGIWJNKORVSI-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO2 |
|---|---|
| Molecular weight | 232.06 g/mol |
| IUPAC name | 1-(1,1-dichloroprop-1-en-2-yl)-2-nitrobenzene |
| InChIKey | YLZGIWJNKORVSI-UHFFFAOYSA-N |
| SMILES | CC(=C(Cl)Cl)C1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)