CAS 477772-56-8 is the registry number for 2,3-Dichloro-n-(2-oxo-ethyl)-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,3-dichloro-N-(2-oxoethyl)benzamide (CAS 477772-56-8) is a chemical compound with the molecular formula C9H7Cl2NO2 and a molecular weight of 232.06 g/mol. IUPAC name: 2,3-dichloro-N-(2-oxoethyl)benzamide. InChIKey: CHHHRORKGRQAER-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO2 |
|---|---|
| Molecular weight | 232.06 g/mol |
| IUPAC name | 2,3-dichloro-N-(2-oxoethyl)benzamide |
| InChIKey | CHHHRORKGRQAER-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=O)NCC=O |
Computed by PubChem (NCBI)