Products 1616434-84-4
CAS 1616434-84-4 is the registry number for trans-hexahydro-4-(phenylmethyl)Cyclopent[b]-1,4-oxazin-6(2H)-one, 95%. Offered by: Chemat. Available pack sizes: 1g.
(4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydrocyclopenta[b][1,4]oxazin-6-one (CAS 1616434-84-4) is a chemical compound with the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. IUPAC name: (4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydrocyclopenta[b][1,4]oxazin-6-one. InChIKey: GBVSKIVZZDRXFM-ZIAGYGMSSA-N.
| Molecular formula | C14H17NO2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydrocyclopenta[b][1,4]oxazin-6-one |
| InChIKey | GBVSKIVZZDRXFM-ZIAGYGMSSA-N |
| SMILES | C1CO[C@@H]2CC(=O)C[C@H]2N1CC3=CC=CC=C3 |
Computed by PubChem (NCBI)