cas: 161735-79-1 — see every product listed under this CAS number, including other names
Rasagiline Mesylate 97% (CAS 161735-79-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 50mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A262921-1mg |
| cas | 161735-79-1 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 131.19 Pln | |
| Ambeed | 50mg | 153.44 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 904.38 Pln | |
| Ambeed | 25g | 2929.12 Pln | |
| Ambeed | 100g | 9426.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A262921 |
Methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine (CAS 161735-79-1) is a chemical compound with the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. IUPAC name: methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine. InChIKey: JDBJJCWRXSVHOQ-UTONKHPSSA-N.
| Molecular formula | C13H17NO3S |
|---|---|
| Molecular weight | 267.35 g/mol |
| IUPAC name | methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
| InChIKey | JDBJJCWRXSVHOQ-UTONKHPSSA-N |
| SMILES | CS(=O)(=O)O.C#CCN[C@@H]1CCC2=CC=CC=C12 |
Computed by PubChem (NCBI)