CAS 1618107-97-3 appears in our catalog under these names: Prasugrel Impurity 13, m-Fluoro Prasugrel Thiolactone(Mixture of Diastereomers), Prasugrel impurity 5. Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, Get quote.
3,5-dimethyl-9-prop-2-enoxyfuro[3,2-g]chromen-7-one (CAS 1618107-97-3) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 3,5-dimethyl-9-prop-2-enoxyfuro[3,2-g]chromen-7-one. InChIKey: YPHYAHLXEZAINX-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 3,5-dimethyl-9-prop-2-enoxyfuro[3,2-g]chromen-7-one |
| InChIKey | YPHYAHLXEZAINX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C(C3=C(C=C12)C(=CO3)C)OCC=C |
Computed by PubChem (NCBI)