CAS 161879-12-5 appears in our catalog under these names: H–Phg–OtBu · HCl, H-L-Phg-OtBu*HCl, H-Phg-OtBu·HCl 97%, H-Phg-OtBu.HCl, 97%, 97%, H-Phg-OtBu.HCl, 99.49%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 5g, 250mg, 1g, 500g, 25 g, 100 g.
Tert-butyl (2S)-2-amino-2-phenylacetate;hydrochloride (CAS 161879-12-5) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: tert-butyl (2S)-2-amino-2-phenylacetate;hydrochloride. InChIKey: CBYKTKOQAVJTOU-PPHPATTJSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-2-phenylacetate;hydrochloride |
| InChIKey | CBYKTKOQAVJTOU-PPHPATTJSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)