Products 256478-95-2
CAS 256478-95-2 appears in our catalog under these names: (R)-tert-Butyl 2-amino-2-phenylacetate hydrochloride, 97%, 97%, D-Phenylglycine tert-butyl ester hydrochloride, 95%, H-D-Phg-OtBu hydrochloride, 98%, (R)–Phenylglycine tert–butyl ester hydrochloride, H-D-Phg-OtBu.HCl 97%. Offered by: Chemat, Fluorochem, Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 100 g, 10 g, 5 g.
Tert-butyl (2R)-2-amino-2-phenylacetate;hydrochloride (CAS 256478-95-2) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: tert-butyl (2R)-2-amino-2-phenylacetate;hydrochloride. InChIKey: CBYKTKOQAVJTOU-HNCPQSOCSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-2-phenylacetate;hydrochloride |
| InChIKey | CBYKTKOQAVJTOU-HNCPQSOCSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
H-D-PHG-OTBU HCL, (R)-Phenylglycine tert-butyl ester hydrochloride, H-D-Phg-OtBu.HCl, (R)-tert-butyl 2-amino-2-phenylacetate hydrochloride, H-D-Phg-OtBu hydrochloride, tert-butyl (2R)-2-amino-2-phenylacetate;hydrochloride, Benzeneacetic acid, a-amino-, 1,1-dimethylethyl ester, hydrochloride,(aR)-, tert-Butyl (R)-2-amino-2-phenylacetate hydrochloride, tert-butyl (2R)-2-amino-2-phenyl-acetate;hydrochloride, D-Phenylglycine tert-butyl ester hydrochloride