Products 162021-14-9
CAS 162021-14-9 appears in our catalog under these names: 2-AMINO-9-HYDROXYMETHYLFLUORENE, 95%, (2–Amino–9H–fluoren–9–yl)methanol, (2-Amino-9H-fluoren-9-yl)methanol 95%, 9H-Fluorene-9-methanol, 2-amino-, 95%, 95%. Offered by: Fluorochem, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2-amino-9H-fluoren-9-yl)methanol (CAS 162021-14-9) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: (2-amino-9H-fluoren-9-yl)methanol. InChIKey: SYEYUWQQBFAPGD-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | (2-amino-9H-fluoren-9-yl)methanol |
| InChIKey | SYEYUWQQBFAPGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C3=C(C=C(C=C3)N)C(C2=C1)CO |
Computed by PubChem (NCBI)