CAS 1620233-77-3 is the registry number for rac-Sitagliptin-d4 Hydrochloride. Offered by: TRC. Available pack sizes: 5mg.
4-bromo-2-nitrobenzaldehyde (CAS 1620233-77-3) is a chemical compound with the molecular formula C7H4BrNO3 and a molecular weight of 230.02 g/mol. IUPAC name: 4-bromo-2-nitrobenzaldehyde. InChIKey: GSXUXSXBEUJRAJ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | 4-bromo-2-nitrobenzaldehyde |
| InChIKey | GSXUXSXBEUJRAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)