Products 1620319-44-9
CAS 1620319-44-9 is the registry number for Methyl 2-(4-bromophenyl)benzofuran-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(4-bromophenyl)-1-benzofuran-3-carboxylate (CAS 1620319-44-9) is a chemical compound with the molecular formula C16H11BrO3 and a molecular weight of 331.16 g/mol. IUPAC name: methyl 2-(4-bromophenyl)-1-benzofuran-3-carboxylate. InChIKey: RKODVXGDSXAHQR-UHFFFAOYSA-N.
| Molecular formula | C16H11BrO3 |
|---|---|
| Molecular weight | 331.16 g/mol |
| IUPAC name | methyl 2-(4-bromophenyl)-1-benzofuran-3-carboxylate |
| InChIKey | RKODVXGDSXAHQR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(OC2=CC=CC=C21)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)