Products 20380-77-2
CAS 20380-77-2 is the registry number for 2-(3-Bromo-4-methoxyphenyl)-1H-indene-1,3(2H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-bromo-4-methoxyphenyl)indene-1,3-dione (CAS 20380-77-2) is a chemical compound with the molecular formula C16H11BrO3 and a molecular weight of 331.16 g/mol. IUPAC name: 2-(3-bromo-4-methoxyphenyl)indene-1,3-dione. InChIKey: HQJOZUPGLTXBAD-UHFFFAOYSA-N.
| Molecular formula | C16H11BrO3 |
|---|---|
| Molecular weight | 331.16 g/mol |
| IUPAC name | 2-(3-bromo-4-methoxyphenyl)indene-1,3-dione |
| InChIKey | HQJOZUPGLTXBAD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2C(=O)C3=CC=CC=C3C2=O)Br |
Computed by PubChem (NCBI)