CAS 351339-24-7 is the registry number for 3-(Benzo[d][1,3]dioxol-5-yl)-1-(3-bromophenyl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(1,3-benzodioxol-5-yl)-1-(3-bromophenyl)prop-2-en-1-one (CAS 351339-24-7) is a chemical compound with the molecular formula C16H11BrO3 and a molecular weight of 331.16 g/mol. IUPAC name: (E)-3-(1,3-benzodioxol-5-yl)-1-(3-bromophenyl)prop-2-en-1-one. InChIKey: MAJHDFAXIFGSGC-GQCTYLIASA-N.
| Molecular formula | C16H11BrO3 |
|---|---|
| Molecular weight | 331.16 g/mol |
| IUPAC name | (E)-3-(1,3-benzodioxol-5-yl)-1-(3-bromophenyl)prop-2-en-1-one |
| InChIKey | MAJHDFAXIFGSGC-GQCTYLIASA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C/C(=O)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)