CAS 215999-39-6 appears in our catalog under these names: 3-Bromo-6-methoxy-2-phenyl-4H-chromen-4-one, 95%, 3–Bromo–6–methoxy–2–phenyl–4H–chromen–4–one. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 250mg.
3-bromo-6-methoxy-2-phenylchromen-4-one (CAS 215999-39-6) is a chemical compound with the molecular formula C16H11BrO3 and a molecular weight of 331.16 g/mol. IUPAC name: 3-bromo-6-methoxy-2-phenylchromen-4-one. InChIKey: BHKMXGOQUDKUEH-UHFFFAOYSA-N.
| Molecular formula | C16H11BrO3 |
|---|---|
| Molecular weight | 331.16 g/mol |
| IUPAC name | 3-bromo-6-methoxy-2-phenylchromen-4-one |
| InChIKey | BHKMXGOQUDKUEH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC(=C(C2=O)Br)C3=CC=CC=C3 |
Computed by PubChem (NCBI)