Products 2651958-65-3
CAS 2651958-65-3 is the registry number for (E)-4-(3-(2-Bromophenyl)-3-oxoprop-1-en-1-yl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(E)-3-(2-bromophenyl)-3-oxoprop-1-enyl]benzoic acid (CAS 2651958-65-3) is a chemical compound with the molecular formula C16H11BrO3 and a molecular weight of 331.16 g/mol. IUPAC name: 4-[(E)-3-(2-bromophenyl)-3-oxoprop-1-enyl]benzoic acid. InChIKey: LPXKPIOQNNBOPU-JXMROGBWSA-N.
| Molecular formula | C16H11BrO3 |
|---|---|
| Molecular weight | 331.16 g/mol |
| IUPAC name | 4-[(E)-3-(2-bromophenyl)-3-oxoprop-1-enyl]benzoic acid |
| InChIKey | LPXKPIOQNNBOPU-JXMROGBWSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)/C=C/C2=CC=C(C=C2)C(=O)O)Br |
Computed by PubChem (NCBI)