CAS 1620620-05-4 is the registry number for Boc-L-Ser(Ph)-OH. Offered by: Iris Biotech. Available pack sizes: on request.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenoxypropanoic acid (CAS 1620620-05-4) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenoxypropanoic acid. InChIKey: GLJIBFIPECEVPM-NSHDSACASA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenoxypropanoic acid |
| InChIKey | GLJIBFIPECEVPM-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)