CAS 1621-70-1 is the registry number for 3'-Hydroxy-4'-methoxyflavanone. Offered by: TRC. Available pack sizes: 1g.
2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one (CAS 1621-70-1) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one. InChIKey: DJCDENZLUWIEMU-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | DJCDENZLUWIEMU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2CC(=O)C3=CC=CC=C3O2)O |
Computed by PubChem (NCBI)