CAS 162110-24-9 appears in our catalog under these names: Flumazenil Impurity 2, Flumazenil Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
7-hydroxy-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione (CAS 162110-24-9) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 7-hydroxy-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione. InChIKey: FTOAJJVDKFYCGO-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 7-hydroxy-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
| InChIKey | FTOAJJVDKFYCGO-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)NC2=C(C1=O)C=C(C=C2)O |
Computed by PubChem (NCBI)