CAS 1621587-41-4 is the registry number for 4-Chloro-5,7-dimethoxy-2H-chromen-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-5,7-dimethoxychromen-2-one (CAS 1621587-41-4) is a chemical compound with the molecular formula C11H9ClO4 and a molecular weight of 240.64 g/mol. IUPAC name: 4-chloro-5,7-dimethoxychromen-2-one. InChIKey: KRYYHPSOBZBXJF-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO4 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | 4-chloro-5,7-dimethoxychromen-2-one |
| InChIKey | KRYYHPSOBZBXJF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=CC(=O)O2)Cl |
Computed by PubChem (NCBI)