Products 451485-68-0
CAS 451485-68-0 appears in our catalog under these names: Methyl 4-(2-chlorophenyl)-2,4-dioxobutanoate, 95%, Methyl 4-(2-chlorophenyl)-2,4-dioxobutanoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
Methyl 4-(2-chlorophenyl)-2,4-dioxobutanoate (CAS 451485-68-0) is a chemical compound with the molecular formula C11H9ClO4 and a molecular weight of 240.64 g/mol. IUPAC name: methyl 4-(2-chlorophenyl)-2,4-dioxobutanoate. InChIKey: GNKBFLQRYZPLOA-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO4 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | methyl 4-(2-chlorophenyl)-2,4-dioxobutanoate |
| InChIKey | GNKBFLQRYZPLOA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC=CC=C1Cl |
Computed by PubChem (NCBI)