CAS 67837-36-9 is the registry number for 2-Chloro-5,7-dimethoxy-4H-chromen-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-5,7-dimethoxychromen-4-one (CAS 67837-36-9) is a chemical compound with the molecular formula C11H9ClO4 and a molecular weight of 240.64 g/mol. IUPAC name: 2-chloro-5,7-dimethoxychromen-4-one. InChIKey: KGEMQAJBBUHXFN-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO4 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | 2-chloro-5,7-dimethoxychromen-4-one |
| InChIKey | KGEMQAJBBUHXFN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=O)C=C(O2)Cl |
Computed by PubChem (NCBI)