CAS 851721-93-2 appears in our catalog under these names: 3-(8-Chloro-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoic acid, 95%, (2E)-3-(8-Chloro-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoic acid (CAS 851721-93-2) is a chemical compound with the molecular formula C11H9ClO4 and a molecular weight of 240.64 g/mol. IUPAC name: (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoic acid. InChIKey: JNDFDEZJZXAHBU-OWOJBTEDSA-N.
| Molecular formula | C11H9ClO4 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoic acid |
| InChIKey | JNDFDEZJZXAHBU-OWOJBTEDSA-N |
| SMILES | C1COC2=C(O1)C=C(C=C2Cl)/C=C/C(=O)O |
Computed by PubChem (NCBI)