CAS 39757-35-2 appears in our catalog under these names: Methyl 4-(4-chlorophenyl)-2,4-dioxobutanoate, 98%, Methyl 4-(4-chlorophenyl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 25g.
Methyl 4-(4-chlorophenyl)-2,4-dioxobutanoate (CAS 39757-35-2) is a chemical compound with the molecular formula C11H9ClO4 and a molecular weight of 240.64 g/mol. IUPAC name: methyl 4-(4-chlorophenyl)-2,4-dioxobutanoate. InChIKey: PIULUHUQDVELBO-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO4 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | methyl 4-(4-chlorophenyl)-2,4-dioxobutanoate |
| InChIKey | PIULUHUQDVELBO-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)