Products 162271-15-0
CAS 162271-15-0 appears in our catalog under these names: 2-Bromo-4-(1,3-dioxolan-2-yl)phenol, 95%, 2-Bromo-4-(1,3-dioxolan-2-yl)phenol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
2-bromo-4-(1,3-dioxolan-2-yl)phenol (CAS 162271-15-0) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-bromo-4-(1,3-dioxolan-2-yl)phenol. InChIKey: WWWAJAPPWHAJOK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-bromo-4-(1,3-dioxolan-2-yl)phenol |
| InChIKey | WWWAJAPPWHAJOK-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(C=C2)O)Br |
Computed by PubChem (NCBI)