CAS 1623083-71-5 appears in our catalog under these names: 5-Phenyl-2-(1h-pyrrol-1-yl)-1,3-thiazole-4-carboxylic acid, 95%, 5-Phenyl-2-(1H-pyrrol-1-yl)thiazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-phenyl-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid (CAS 1623083-71-5) is a chemical compound with the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. IUPAC name: 5-phenyl-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid. InChIKey: LXNPNDVRXFRCHE-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | 5-phenyl-2-pyrrol-1-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | LXNPNDVRXFRCHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(S2)N3C=CC=C3)C(=O)O |
Computed by PubChem (NCBI)