CAS 488722-57-2 is the registry number for 6-Methyl-2-(4-nitrophenyl)benzothiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
6-methyl-2-(4-nitrophenyl)-1,3-benzothiazole (CAS 488722-57-2) is a chemical compound with the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. IUPAC name: 6-methyl-2-(4-nitrophenyl)-1,3-benzothiazole. InChIKey: YYVNJMDZXBHEAA-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | 6-methyl-2-(4-nitrophenyl)-1,3-benzothiazole |
| InChIKey | YYVNJMDZXBHEAA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(S2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)