CAS 669708-39-8 appears in our catalog under these names: 2-(Phenylsulfonyl)-3-(3-pyridyl)prop-2-enenitrile, 2-(Phenylsulfonyl)-3-(3-pyridyl)prop-2-enenitrile, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 10g, 25g, 1g.
(E)-2-(benzenesulfonyl)-3-pyridin-3-ylprop-2-enenitrile (CAS 669708-39-8) is a chemical compound with the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. IUPAC name: (E)-2-(benzenesulfonyl)-3-pyridin-3-ylprop-2-enenitrile. InChIKey: NRQRQNPEJRBKDO-NTEUORMPSA-N.
| Molecular formula | C14H10N2O2S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | (E)-2-(benzenesulfonyl)-3-pyridin-3-ylprop-2-enenitrile |
| InChIKey | NRQRQNPEJRBKDO-NTEUORMPSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)/C(=C/C2=CN=CC=C2)/C#N |
Computed by PubChem (NCBI)