CAS 1810092-90-0 is the registry number for N-Benzyl-N-demethylpronqodine A. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(benzylamino)-1,2-benzothiazole-4,7-dione (CAS 1810092-90-0) is a chemical compound with the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. IUPAC name: 5-(benzylamino)-1,2-benzothiazole-4,7-dione. InChIKey: REQNSASITZCQGJ-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | 5-(benzylamino)-1,2-benzothiazole-4,7-dione |
| InChIKey | REQNSASITZCQGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC(=O)C3=C(C2=O)C=NS3 |
Computed by PubChem (NCBI)