Products 220192-02-9
CAS 220192-02-9 appears in our catalog under these names: 1-Phenyl-5-(2-thienyl)-1h-pyrazole-3-carboxylic acid, 95%, 1-Phenyl-5-(2-thienyl)-1H-pyrazole-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg.
1-phenyl-5-thiophen-2-ylpyrazole-3-carboxylic acid (CAS 220192-02-9) is a chemical compound with the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. IUPAC name: 1-phenyl-5-thiophen-2-ylpyrazole-3-carboxylic acid. InChIKey: GVUATZWSTXLFCR-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | 1-phenyl-5-thiophen-2-ylpyrazole-3-carboxylic acid |
| InChIKey | GVUATZWSTXLFCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC(=N2)C(=O)O)C3=CC=CS3 |
Computed by PubChem (NCBI)