CAS 1625-72-5 appears in our catalog under these names: H–Cys(Z)–OH, H-Cys(Cbz)-OH 95%, H-Cys(Z)-OH, 95%, 95%, H-Cys(Z)-OH, 99.63%, (R)-2-Amino-3-(((benzyloxy)carbonyl)thio)propanoic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 100g, 25g, 1g, 5g, 10 g, 25 g, 100 g.
(2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid (CAS 1625-72-5) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid. InChIKey: IAZGSEXFFGHKDF-VIFPVBQESA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | (2R)-2-amino-3-phenylmethoxycarbonylsulfanylpropanoic acid |
| InChIKey | IAZGSEXFFGHKDF-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)SC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)