CAS 162611-57-6 is the registry number for N,N-Dihydroxy-L-tyrosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,N-dihydroxy-L-tyrosine is a L-tyrosine derivative and a N,N-dihydroxy-alpha-amino acid. It is a conjugate acid of a N,N-dihydroxy-L-tyrosinate.
Source: ChEBI
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | (2S)-2-(dihydroxyamino)-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | QPHSFUGCBGILSS-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)N(O)O)O |
Computed by PubChem (NCBI)