CAS 1628860-82-1 is the registry number for 4-Chloro-N-hydroxy-2-(trifluoromethyl)benzimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N'-hydroxy-2-(trifluoromethyl)benzenecarboximidamide (CAS 1628860-82-1) is a chemical compound with the molecular formula C8H6ClF3N2O and a molecular weight of 238.59 g/mol. IUPAC name: 4-chloro-N'-hydroxy-2-(trifluoromethyl)benzenecarboximidamide. InChIKey: OKARUWMOWLVBHX-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3N2O |
|---|---|
| Molecular weight | 238.59 g/mol |
| IUPAC name | 4-chloro-N'-hydroxy-2-(trifluoromethyl)benzenecarboximidamide |
| InChIKey | OKARUWMOWLVBHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)/C(=N/O)/N |
Computed by PubChem (NCBI)