CAS 928256-34-2 is the registry number for 4-Chloro-n-(2,2,2-trifluoroethyl)pyridine-2-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (CAS 928256-34-2) is a chemical compound with the molecular formula C8H6ClF3N2O and a molecular weight of 238.59 g/mol. IUPAC name: 4-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide. InChIKey: IOPYEKQGPJVSAV-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3N2O |
|---|---|
| Molecular weight | 238.59 g/mol |
| IUPAC name | 4-chloro-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| InChIKey | IOPYEKQGPJVSAV-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)C(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)