Products 1820707-59-2
CAS 1820707-59-2 is the registry number for 5-(trifluoromethyl)-1,3-benzoxazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(trifluoromethyl)-1,3-benzoxazol-2-amine;hydrochloride (CAS 1820707-59-2) is a chemical compound with the molecular formula C8H6ClF3N2O and a molecular weight of 238.59 g/mol. IUPAC name: 5-(trifluoromethyl)-1,3-benzoxazol-2-amine;hydrochloride. InChIKey: BPJWSNYQAMPEDU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3N2O |
|---|---|
| Molecular weight | 238.59 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1,3-benzoxazol-2-amine;hydrochloride |
| InChIKey | BPJWSNYQAMPEDU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(O2)N.Cl |
Computed by PubChem (NCBI)