CAS 1702253-11-9 is the registry number for 2-Chloro-n-(2,2-difluoroethyl)-5-fluoropyridine-3-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-N-(2,2-difluoroethyl)-5-fluoropyridine-3-carboxamide (CAS 1702253-11-9) is a chemical compound with the molecular formula C8H6ClF3N2O and a molecular weight of 238.59 g/mol. IUPAC name: 2-chloro-N-(2,2-difluoroethyl)-5-fluoropyridine-3-carboxamide. InChIKey: JIRCVULEVMJMPA-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3N2O |
|---|---|
| Molecular weight | 238.59 g/mol |
| IUPAC name | 2-chloro-N-(2,2-difluoroethyl)-5-fluoropyridine-3-carboxamide |
| InChIKey | JIRCVULEVMJMPA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)NCC(F)F)Cl)F |
Computed by PubChem (NCBI)