Products 477888-16-7
CAS 477888-16-7 is the registry number for 2-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetamide (CAS 477888-16-7) is a chemical compound with the molecular formula C8H6ClF3N2O and a molecular weight of 238.59 g/mol. IUPAC name: 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetamide. InChIKey: KUYHPTSOTBSQCO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3N2O |
|---|---|
| Molecular weight | 238.59 g/mol |
| IUPAC name | 2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]acetamide |
| InChIKey | KUYHPTSOTBSQCO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)CC(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)