CAS 162891-15-8 appears in our catalog under these names: 2-(2-Chloro-6-fluorophenyl)-2-hydroxyacetic acid, 97%, 2-(2-Chloro-6-fluorophenyl)-2-hydroxyacetic acid, 97%, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g, 100g.
2-(2-chloro-6-fluorophenyl)-2-hydroxyacetic acid (CAS 162891-15-8) is a chemical compound with the molecular formula C8H6ClFO3 and a molecular weight of 204.58 g/mol. IUPAC name: 2-(2-chloro-6-fluorophenyl)-2-hydroxyacetic acid. InChIKey: DRIWAGAZEWKZFY-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO3 |
|---|---|
| Molecular weight | 204.58 g/mol |
| IUPAC name | 2-(2-chloro-6-fluorophenyl)-2-hydroxyacetic acid |
| InChIKey | DRIWAGAZEWKZFY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(C(=O)O)O)F |
Computed by PubChem (NCBI)