CAS 16296-42-7 is the registry number for DB28, 99.92%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 25 mg, 50 mg.
N-[(2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)carbonyl]-beta-alanine is a beta-alanine derivative obtained by formal condensation of the carboxy group of orotic acid with the amino group of beta-alanine. One of a series of mucosal-associated invariant T (MAIT) cell agonists. It has a role as a MAIT cell agonist. It is functionally related to an orotic acid.
Source: ChEBI
| Molecular formula | C8H9N3O5 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 3-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]propanoic acid |
| InChIKey | HLVBXSGXJVQJGW-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=O)NC1=O)C(=O)NCCC(=O)O |
Computed by PubChem (NCBI)