Products 1630-34-8
CAS 1630-34-8 appears in our catalog under these names: rac O-Acetyl Pseudoephedrine Hydrochloride, O-Acetyl Pseudoephedrine Hydrochloride, (1S,2S)-O-Acetylpseudoephedrine Hydrochloride. Offered by: TRC, Mikromol. Available pack sizes: 250mg, 25mg, 100mg, 10mg, 50mg.
[(1S,2S)-2-(methylamino)-1-phenylpropyl] acetate;hydrochloride (CAS 1630-34-8) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: [(1S,2S)-2-(methylamino)-1-phenylpropyl] acetate;hydrochloride. InChIKey: BAQONBWCFDKKSC-PKKHVXKMSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | [(1S,2S)-2-(methylamino)-1-phenylpropyl] acetate;hydrochloride |
| InChIKey | BAQONBWCFDKKSC-PKKHVXKMSA-N |
| SMILES | C[C@@H]([C@H](C1=CC=CC=C1)OC(=O)C)NC.Cl |
Computed by PubChem (NCBI)