CAS 163253-02-9 is the registry number for S-(-)-Hydrodolasetron. Offered by: Chemat Brand. Available pack sizes: on request.
[(7S,10S)-10-hydroxy-8-azatricyclo[5.3.1.03,8]undecan-5-yl] 1H-indole-3-carboxylate (CAS 163253-02-9) is a chemical compound with the molecular formula C19H22N2O3 and a molecular weight of 326.4 g/mol. IUPAC name: [(7S,10S)-10-hydroxy-8-azatricyclo[5.3.1.03,8]undecan-5-yl] 1H-indole-3-carboxylate. InChIKey: MLWGAEVSWJXOQJ-PIWLSVLZSA-N.
| Molecular formula | C19H22N2O3 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | [(7S,10S)-10-hydroxy-8-azatricyclo[5.3.1.03,8]undecan-5-yl] 1H-indole-3-carboxylate |
| InChIKey | MLWGAEVSWJXOQJ-PIWLSVLZSA-N |
| SMILES | C1[C@H]2CC(CC3N2C[C@H](C1C3)O)OC(=O)C4=CNC5=CC=CC=C54 |
Computed by PubChem (NCBI)