CAS 16876-74-7 is the registry number for N-Phenyl L-Z-Valinamide, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Benzyl N-[(2S)-1-anilino-3-methyl-1-oxobutan-2-yl]carbamate (CAS 16876-74-7) is a chemical compound with the molecular formula C19H22N2O3 and a molecular weight of 326.4 g/mol. IUPAC name: benzyl N-[(2S)-1-anilino-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: FNZWOLATMXPENQ-KRWDZBQOSA-N.
| Molecular formula | C19H22N2O3 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | benzyl N-[(2S)-1-anilino-3-methyl-1-oxobutan-2-yl]carbamate |
| InChIKey | FNZWOLATMXPENQ-KRWDZBQOSA-N |
| SMILES | CC(C)[C@@H](C(=O)NC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)