CAS 2377355-80-9 is the registry number for tert-Butyl 5-cyano-1-oxo-1,3-dihydrospiro[indene-2,4'-piperidine]-1'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-cyano-3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate (CAS 2377355-80-9) is a chemical compound with the molecular formula C19H22N2O3 and a molecular weight of 326.4 g/mol. IUPAC name: tert-butyl 6-cyano-3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate. InChIKey: WZBPMUBIGLRMEK-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O3 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | tert-butyl 6-cyano-3-oxospiro[1H-indene-2,4'-piperidine]-1'-carboxylate |
| InChIKey | WZBPMUBIGLRMEK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC3=C(C2=O)C=CC(=C3)C#N |
Computed by PubChem (NCBI)