Products 358387-25-4

CAS 358387-25-4 is the registry number for 4-([4-(2-Methoxyphenyl)piperazin-1-yl]methyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzoic acid (CAS 358387-25-4) is a chemical compound with the molecular formula C19H22N2O3 and a molecular weight of 326.4 g/mol. IUPAC name: 4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzoic acid. InChIKey: KPXOKVXKHGAASR-UHFFFAOYSA-N.

Identity
Molecular formulaC19H22N2O3
Molecular weight326.4 g/mol
IUPAC name4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzoic acid
InChIKeyKPXOKVXKHGAASR-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1N2CCN(CC2)CC3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)