Products 2267291-22-3
CAS 2267291-22-3 is the registry number for tert-Butyl 7-(3-hydroxypropyl)-5H-pyrido[4,3-b]indole-5-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 7-(3-hydroxypropyl)pyrido[4,3-b]indole-5-carboxylate (CAS 2267291-22-3) is a chemical compound with the molecular formula C19H22N2O3 and a molecular weight of 326.4 g/mol. IUPAC name: tert-butyl 7-(3-hydroxypropyl)pyrido[4,3-b]indole-5-carboxylate. InChIKey: VIGQVXQHBDAOSH-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O3 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | tert-butyl 7-(3-hydroxypropyl)pyrido[4,3-b]indole-5-carboxylate |
| InChIKey | VIGQVXQHBDAOSH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=NC=C2)C3=C1C=C(C=C3)CCCO |
Computed by PubChem (NCBI)