Products 1638759-59-7
CAS 1638759-59-7 is the registry number for Methyl4-bromo-3-methyl-1H-indole-6-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Methyl 4-bromo-3-methyl-1H-indole-6-carboxylate (CAS 1638759-59-7) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: methyl 4-bromo-3-methyl-1H-indole-6-carboxylate. InChIKey: MUMNFBHWIQDZRZ-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | methyl 4-bromo-3-methyl-1H-indole-6-carboxylate |
| InChIKey | MUMNFBHWIQDZRZ-UHFFFAOYSA-N |
| SMILES | CC1=CNC2=C1C(=CC(=C2)C(=O)OC)Br |
Computed by PubChem (NCBI)